Introduction:Basic information about CAS 16568-56-2|mesobilirubin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | mesobilirubin |
|---|
| CAS Number | 16568-56-2 | Molecular Weight | 588.69400 |
|---|
| Density | 1.283g/cm3 | Boiling Point | 900.9ºC at 760mmHg |
|---|
| Molecular Formula | C33H40N4O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 498.7ºC |
|---|
Names
| Name | mesobilirubin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.283g/cm3 |
|---|
| Boiling Point | 900.9ºC at 760mmHg |
|---|
| Molecular Formula | C33H40N4O6 |
|---|
| Molecular Weight | 588.69400 |
|---|
| Flash Point | 498.7ºC |
|---|
| Exact Mass | 588.29500 |
|---|
| PSA | 164.38000 |
|---|
| LogP | 5.63680 |
|---|
| Vapour Pressure | 6.1E-35mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | HVHKMUMXERBUAN-IFADSCNNSA-N |
|---|
| SMILES | CCC1=C(C)C(=Cc2[nH]c(Cc3[nH]c(C=C4NC(=O)C(C)=C4CC)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC1=O |
|---|
| Storage condition | -20°C |
|---|
Synonyms
| Mesobilirubin |
| 3,18-diethyl-2,7,13,17-tetramethyl-1,19-dioxo-1,19,22,24-tetrahydro-21H-biline-8,12-dipropanoic acid |
| (Z,Z)-Mesobilirubin |
| 3-yl]-propionic acid |
| 3,3'-(2,17-diethyl-3,7,13,18-tetramethyl-1,19-dioxo-1,10,19,22,23,24-hexahydro-21H-biline-8,12-diyl)-bis-propionic acid |
| 3-[2-[[3-(2-carboxyethyl)-5-[(Z)-(3-ethyl-4-methyl-5-oxopyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-2-yl]methyl]-5-[(Z)-(4-ethyl-3-methyl-5-oxopyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid |
| 2,17-diethyl-3,7,13,18-tetramethyl-1,19-dioxo-1,10,19,22,23,24-hexahydro-21H-biline-8,12-dipropanoic acid |
| 3-(2-(3-(2-Carboxy-ethyl)-5-(4-ethyl-3-methyl-5-oxo-1,5-dihydro-pyrrol-2-ylidenemethyl)-4-methyl-1H-pyrrol-2-ylmethyl)-5-(3-ethyl-4-methyl-5-oxo-1,5-dihydro-pyrrol-2-ylidenemethyl)-4-methyl-1H-pyrrol-3-yl)-propionic acid |