Introduction：Basic information about CAS 3978-58-3|3-[Dimethoxy(methyl)silyl]propyl methacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[Dimethoxy(methyl)silyl]propyl methacrylate |
|---|
| CAS Number | 3978-58-3 | Molecular Weight | 232.349 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 258.0±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H20O4Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 91.4±18.2 °C |
|---|
Names
| Name | [diethoxy(methyl)silyl]methyl 2-methylprop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 258.0±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H20O4Si |
|---|
| Molecular Weight | 232.349 |
|---|
| Flash Point | 91.4±18.2 °C |
|---|
| Exact Mass | 232.113083 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 1.20 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.429 |
|---|
| InChIKey | GXDZOSLIAABYHM-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)C(=O)OC[Si](C)(OCC)OCC |
|---|
| Storage condition | below 5° C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 23-24/25-26-36/37/39 |
|---|
Synonyms
| 2-Propenoic acid,2-methyl-,(diethoxymethylsilyl)methyl ester |
| Geniosil XL 34 |
| 3-[Dimethoxy(methyl)silyl]propyl methacrylate |
| methacryloxymethyl(diethoxy)methylsilane |
| (METHACRYLOXYMETHYL)METHYLDIETHOXYSILANE |
| (methacryloyloxymethyl)diethoxymethylsilane |
| 2-Propenoic acid, 2-methyl-, 3-(dimethoxymethylsilyl)propyl ester |
| Diaethoxy-methacryloyloxymethyl-methyl-silan |
| Diethoxy(methacryloyloxymethyl)methylsilane |
| methacryloyloxymethyl-(methyl)diethoxysilane |
| Diaethoxy-methy-methacryloyloxymethyl-silan |
| Methanol,(diethoxymethylsilyl)-,methacrylate (8CI) |
