Introduction:Basic information about CAS 41622-04-2|N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]phenyl]ace, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]phenyl]acetamide |
|---|
| CAS Number | 41622-04-2 | Molecular Weight | 519.34900 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 724.2ºC at 760mmHg |
|---|
| Molecular Formula | C21H23BrN6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 391.8ºC |
|---|
Names
| Name | N-[5-[bis(2-methoxyethyl)amino]-2-[(2-bromo-6-cyano-4-nitrophenyl)diazenyl]phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 724.2ºC at 760mmHg |
|---|
| Molecular Formula | C21H23BrN6O5 |
|---|
| Molecular Weight | 519.34900 |
|---|
| Flash Point | 391.8ºC |
|---|
| Exact Mass | 518.09100 |
|---|
| PSA | 145.13000 |
|---|
| LogP | 5.29818 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | IMTYOCTYFKYQBZ-UHFFFAOYSA-N |
|---|
| SMILES | COCCN(CCOC)c1ccc(N=Nc2c(Br)cc([N+](=O)[O-])cc2C#N)c(NC(C)=O)c1 |
|---|
Synonyms
| EINECS 255-467-5 |
| Acetamide,N-(5-(bis(2-methoxyethyl)amino)-2-(2-(2-bromo-6-cyano-4-nitrophenyl)diazenyl)phenyl) |
| Acetamide,N-(5-(bis(2-methoxyethyl)amino)-2-((2-bromo-6-cyano-4-nitrophenyl)azo)phenyl) |
| N-(5-(Bis(2-methoxyethyl)amino)-2-((2-bromo-6-cyano-4-nitrophenyl)azo)phenyl)acetamide |