Introduction:Basic information about CAS 25510-81-0|3-[ethyl[4-[(6-nitrobenzothiazol-2-yl)azo]phenyl]amino]propiononitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-[ethyl[4-[(6-nitrobenzothiazol-2-yl)azo]phenyl]amino]propiononitrile |
|---|
| CAS Number | 25510-81-0 | Molecular Weight | 380.42400 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 616.2ºC at 760mmHg |
|---|
| Molecular Formula | C18H16N6O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 326.4ºC |
|---|
Names
| Name | 3-[N-ethyl-4-[(6-nitro-1,3-benzothiazol-2-yl)diazenyl]anilino]propanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 616.2ºC at 760mmHg |
|---|
| Molecular Formula | C18H16N6O2S |
|---|
| Molecular Weight | 380.42400 |
|---|
| Flash Point | 326.4ºC |
|---|
| Exact Mass | 380.10600 |
|---|
| PSA | 138.70000 |
|---|
| LogP | 5.88308 |
|---|
| Vapour Pressure | 4.09E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.691 |
|---|
| InChIKey | PWUVCFDFTBWAFJ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CCC#N)c1ccc(N=Nc2nc3ccc([N+](=O)[O-])cc3s2)cc1 |
|---|
Synonyms
| Benzothiazole,2-((p-(N-(2-cyanoethyl)-N-ethylamino)phenylazo)-6-nitro |
| 3-(Ethyl(4-((6-nitrobenzothiazol-2-yl)azo)phenyl)amino)propiononitrile |
| 3-(ethyl{4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino)propanenitrile |
| Propanenitrile,3-(ethyl(4-((6-nitro-2-benzothiazolyl)azo)phenyl)amino) |
| EINECS 247-055-9 |