CAS 36635-61-7|Tosylmethyl isocyanide
Introduction：Basic information about CAS 36635-61-7|Tosylmethyl isocyanide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tosylmethyl isocyanide | ||
|---|---|---|---|
| CAS Number | 36635-61-7 | Molecular Weight | 195.238 |
| Density | 1.24 g/cm3 | Boiling Point | 400.9ºC at 760 mmHg |
| Molecular Formula | C9H9NO2S | Melting Point | 109-113 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 196.3ºC |
| Symbol | GHS06 | Signal Word | Danger |
Names
| Name | Tosylmethyl isocyanide |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.24 g/cm3 |
|---|---|
| Boiling Point | 400.9ºC at 760 mmHg |
| Melting Point | 109-113 °C(lit.) |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.238 |
| Flash Point | 196.3ºC |
| Exact Mass | 195.035400 |
| PSA | 42.52000 |
| LogP | 1.95700 |
| InChIKey | CFOAUYCPAUGDFF-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]CS(=O)(=O)c1ccc(C)cc1 |
| Storage condition | -20°C |
| Water Solubility | insoluble |
Safety Information
| Symbol | GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331 |
| Precautionary Statements | P261-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S36/37-S45-S38-S36/37/39-S28A |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 29299000 |
Customs
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
Articles7
More Articles| Microwave-assisted synthesis of imidazoles: reaction of p-toluenesulfonylmethyl isocyanide and polymer-bound imines. Bioorg. Med. Chem. Lett. 15(16) , 3717-9, (2005) A convenient method for the synthesis of 1,5-disubstituted imidazoles has been developed on a polymeric support using base-promoted 1,3-dipolar cycloaddition reaction of p-toluenesulfonylmethyl isocya... | |
| Synthesis of novel triplet drugs with 1,3,5-trioxazatriquinane skeletons and their pharmacologies. Part 2: Synthesis of novel triplet drugs with the epoxymethano structure (capped homotriplet). Bioorg. Med. Chem. Lett. 21(20) , 6198-202, (2011) An improved synthetic method for triplet drugs with the 1,3,5-trioxazatriquinane skeleton was developed that used p-toluenesulfonylmethyl isocyanide (TosMIC) instead of 1,3-dithiane. Using the improve... | |
| Alkyl and aromatic isocyanide binding to haem complexes. Biochem. J. 262(3) , 959-63, (1989) Equilibrium constants for the binding of ethyl (EIC), n-butyl (BIC), p-toluenesulphonylmethyl (TMIC) and 2,6-dimethylphenyl isocyanides (DIMPI) to an imidazole-haem complex in toluene and aqueous dete... |
Synonyms
| TosMICTosylmethyl Isocyanide |
| 4-toluene-sulfonylmethyl isocyanide |
| (p-Tolylsulfonyl)methyl isocyanide |
| Tosylmethy isocyanide |
| Tosylmethylisocyanide |
| Isocyanomethyl 4-methylphenyl sulfone |
| Benzene, 1-((isocyanomethyl)sulfonyl)-4-methyl- |
| p-Toluenesulfonylmethyl isocyanide |
| 1-[(Isocyanomethyl)sulfonyl]-4-methylbenzene |
| 4-Toluenesulfonylmethyl isocyanide |
| P-tolysulfonylmethylisocyanide |
| p-tosylmethyl isocyanide |
| 4-Toluenesulfonylmethylisocyanide |
| TOSMIC |
| EINECS 253-140-1 |
| p-Toluenesulfonyl Isocyanide |
| Tosylmethyl isocyani |
| MFCD00000005 |
| Benzene, 1-[(isocyanomethyl)sulfonyl]-4-methyl- |
| IsocyanoMethyl p-Tolyl Sulfone |
| 1-[(Isocyanmethyl)sulfonyl]-4-methylbenzol |
| 4-Toluenesulphonylmethyl Isocyanide |
