Introduction：Basic information about CAS 612-36-2|2,4'-dinitrodiphenylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4'-dinitrodiphenylamine |
|---|
| CAS Number | 612-36-2 | Molecular Weight | 259.21800 |
|---|
| Density | 1.446g/cm3 | Boiling Point | 434.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.4ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-nitro-N-(4-nitrophenyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.446g/cm3 |
|---|
| Boiling Point | 434.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 |
|---|
| Molecular Weight | 259.21800 |
|---|
| Flash Point | 216.4ºC |
|---|
| Exact Mass | 259.05900 |
|---|
| PSA | 103.67000 |
|---|
| LogP | 4.36600 |
|---|
| Index of Refraction | 1.693 |
|---|
| InChIKey | TXJIDOLTOGSNPD-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2[N+](=O)[O-])cc1 |
|---|
| Storage condition | ?20°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 2.4'-Dinitro-diphenylamin |
| Benzenamine,2-nitro-N-(4-nitrophenyl) |
| 2-nitro-N-(4-nitrophenyl)-benzenamine |
| EINECS 210-306-8 |
| 2,4'-Dinitrodiphenylamine |
| 2,3-DIFLUOROPHENACYL BROMIDE |
| Diphenylamine,2,4'-dinitro |
| MFCD01861531 |
| (2-nitro-phenyl)-(4-nitro-phenyl)-amine |
