Introduction：Basic information about CAS 25216-74-4|tert-butyl (3-bromophenyl)carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl (3-bromophenyl)carbamate |
|---|
| CAS Number | 25216-74-4 | Molecular Weight | 272.138 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 279.6±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H14BrNO2 | Melting Point | 86-89ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 122.9±22.6 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl N-(3-bromophenyl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 279.6±23.0 °C at 760 mmHg |
|---|
| Melting Point | 86-89ºC(lit.) |
|---|
| Molecular Formula | C11H14BrNO2 |
|---|
| Molecular Weight | 272.138 |
|---|
| Flash Point | 122.9±22.6 °C |
|---|
| Exact Mass | 271.020782 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.98 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | VDFBCTSISJDKNW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Br)c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26;S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| tert-butyl (3-bromophenyl)carbamate |
| 2-Methyl-2-propanyl (3-bromophenyl)carbamate |
| N-(3-bromophenyl)-carbamic acid 1,1-dimethylethyl ether |
| N-tert-butoxycarbonyl-3-bromoaniline |
| N-Boc 3-bromoaniline |
| Carbamic acid, N-(3-bromophenyl)-, 1,1-dimethylethyl ester |
| (3-bromo-phenyl)-carbamic acid t-butyl ester |
| 3-Br-Ph-NHBoc |
| 3-Bromo-N-tert-butoxycarbonylaniline |
| MFCD01006618 |
