Introduction：Basic information about CAS 25084-14-4|5-nitro-2-furoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-nitro-2-furoyl chloride |
|---|
| CAS Number | 25084-14-4 | Molecular Weight | 175.52700 |
|---|
| Density | 1.588g/cm3 | Boiling Point | 137-140°C 15mm |
|---|
| Molecular Formula | C5H2ClNO4 | Melting Point | 38-40°C |
|---|
| MSDS | ChineseUSA | Flash Point | 137-140°C/15mm |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 5-nitrofuran-2-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.588g/cm3 |
|---|
| Boiling Point | 137-140°C 15mm |
|---|
| Melting Point | 38-40°C |
|---|
| Molecular Formula | C5H2ClNO4 |
|---|
| Molecular Weight | 175.52700 |
|---|
| Flash Point | 137-140°C/15mm |
|---|
| Exact Mass | 174.96700 |
|---|
| PSA | 76.03000 |
|---|
| LogP | 2.09000 |
|---|
| Vapour Pressure | 0.00598mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | OLEFNFXYGGTROA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc([N+](=O)[O-])o1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-Furoyl chloride,5-nitro |
| 5-nitrofuran-2-carbonylchloride |
| 5-Nitrofuroyl chloride |
| MFCD00039564 |
| EINECS 246-607-6 |
| 5-nitrofuran-2-carboxylic chloride |
| 5-Nitrofuran-2-carboxylic acid chloride |
| 5-nitrofurancarboxylic acid chloride |
| 2-Furancarbonyl chloride,5-nitro |
| 5-nitro-2-furane-carbonyl chloride |
| 5-nitro-2-furancarboxylic acid chloride |
