Introduction：Basic information about CAS 2564-05-8|2-Chloro-N-(3-chlorophenyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-N-(3-chlorophenyl)acetamide |
|---|
| CAS Number | 2564-05-8 | Molecular Weight | 204.053 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 365.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7Cl2NO | Melting Point | 93ºC |
|---|
| MSDS | / | Flash Point | 174.6±23.7 °C |
|---|
Names
| Name | 2-chloro-n-(3-chlorophenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 365.0±27.0 °C at 760 mmHg |
|---|
| Melting Point | 93ºC |
|---|
| Molecular Formula | C8H7Cl2NO |
|---|
| Molecular Weight | 204.053 |
|---|
| Flash Point | 174.6±23.7 °C |
|---|
| Exact Mass | 202.990463 |
|---|
| PSA | 29.10000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | KNVBYGNINQITJC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCl)Nc1cccc(Cl)c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,3'-Dichloroacetanilide |
| Acetamide, 2-chloro-N-(3-chlorophenyl)- |
| [(3-chlorophenyl)aminocarbonylmethyl]chloride |
| 2-chloro-N-(3-chloro-phenyl)-acetamide |
| Acetanilide,2,3'-dichloro |
| N-(3-chlorophenyl)chloroacetamide |
| Acetamide,N-(3-chlorophenyl)-2-chloro |
| 3-chloro-N-(chloroacetyl)aniline |
| 2-Chloro-N-(3-chlorophenyl)acetamide |
| MFCD00018896 |
| N-(3-chlorophenyl)-2-chloroacetamide |
