Introduction:Basic information about CAS 13395-36-3|5,5-Dimethyl-2,4-dioxohexanoic Acid Ethyl Ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5-Dimethyl-2,4-dioxohexanoic Acid Ethyl Ester |
|---|
| CAS Number | 13395-36-3 | Molecular Weight | 200.23200 |
|---|
| Density | 1.046g/cm3 | Boiling Point | 68ºC (0.5 torr) |
|---|
| Molecular Formula | C10H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 106.7ºC |
|---|
Names
| Name | Ethyl 5,5-dimethyl-2,4-dioxohexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.046g/cm3 |
|---|
| Boiling Point | 68ºC (0.5 torr) |
|---|
| Molecular Formula | C10H16O4 |
|---|
| Molecular Weight | 200.23200 |
|---|
| Flash Point | 106.7ºC |
|---|
| Exact Mass | 200.10500 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 1.12390 |
|---|
| Vapour Pressure | 4.06E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.47 |
|---|
| InChIKey | NIMKIMUBJFWPTD-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)CC(=O)C(C)(C)C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S24/25 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00052319 |
| Ethyl trimethylacetopyruvate |
| EINECS 236-478-4 |
| ethyl 5,5-dimethyl-2,4-dioxohexanoate |