Introduction:Basic information about CAS 16761-18-5|Benzenesulfonylchloride, 4-(acetylamino)-3-chloro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonylchloride, 4-(acetylamino)-3-chloro- |
|---|
| CAS Number | 16761-18-5 | Molecular Weight | 268.11700 |
|---|
| Density | 1.566g/cm3 | Boiling Point | 447.3ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7Cl2NO3S | Melting Point | 143 °C |
|---|
| MSDS | USA | Flash Point | 224.3ºC |
|---|
Names
| Name | 4-acetamido-3-chlorobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.566g/cm3 |
|---|
| Boiling Point | 447.3ºC at 760 mmHg |
|---|
| Melting Point | 143 °C |
|---|
| Molecular Formula | C8H7Cl2NO3S |
|---|
| Molecular Weight | 268.11700 |
|---|
| Flash Point | 224.3ºC |
|---|
| Exact Mass | 266.95200 |
|---|
| PSA | 71.62000 |
|---|
| LogP | 3.37970 |
|---|
| Vapour Pressure | 3.39E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | ALOQYFFSHSEVJH-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Cl)cc1Cl |
|---|
| Storage condition | 2-8℃ |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S27-S36/37/39 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-acetamido-3-chlorobenzene-1-sulfonyl chloride |
| 4-Acetylamino-3-chlor-benzolsulfonylchlorid |
| MFCD00052363 |
| 3-Chlor-4-acetamino-benzol-sulfonylchlorid-(1) |
| 4-acetamido-3-chlorobenzenesulphonyl chloride |
| N-acetyl-2-chloro-4-chlorosulphonylaniline |
| 4-(Acetylamino)-3-chlorobenzene-1-sulfonyl chloride |
| 4-acetamido-3-chlorophenylsulfonyl chloride |
| 4-(acetylamino)-3-chlorobenzenesulfonyl chloride |