Introduction：Basic information about CAS 442670-42-0|2-[3-chloro-4-(trifluoromethyl)phenyl]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[3-chloro-4-(trifluoromethyl)phenyl]benzoic acid |
|---|
| CAS Number | 442670-42-0 | Molecular Weight | 300.66000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H8ClF3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[3-chloro-4-(trifluoromethyl)phenyl]benzoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H8ClF3O2 |
|---|
| Molecular Weight | 300.66000 |
|---|
| Exact Mass | 300.01600 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.72400 |
|---|
| InChIKey | BFBPEAMTGIGDID-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccccc1-c1ccc(C(F)(F)F)c(Cl)c1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
