Introduction：Basic information about CAS 619-31-8|Benzenamine,N,N-dimethyl-3-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenamine,N,N-dimethyl-3-nitro- |
|---|
| CAS Number | 619-31-8 | Molecular Weight | 166.17700 |
|---|
| Density | 1.313(17/4ºC) | Boiling Point | 280 °C |
|---|
| Molecular Formula | C8H10N2O2 | Melting Point | 57-61 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | n,n-dimethyl-3-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.313(17/4ºC) |
|---|
| Boiling Point | 280 °C |
|---|
| Melting Point | 57-61 °C |
|---|
| Molecular Formula | C8H10N2O2 |
|---|
| Molecular Weight | 166.17700 |
|---|
| Exact Mass | 166.07400 |
|---|
| PSA | 49.06000 |
|---|
| LogP | 2.18400 |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | CJDICMLSLYHRPT-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | T,Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S45-S36/37/39-S26-S36/37 |
|---|
| RIDADR | 2811 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| m-Nitro-N,N-dimethylaniline |
| MFCD00007236 |
| meta-nitro N,N-dimethylaniline |
| 3-Nitro-N,N-dimethylaniline |
| N,N-Dimethyl-m-nitroaniline |
| Aniline,N,N-dimethyl-m-nitro |
| EINECS 210-590-3 |
| Benzenamine,N,N-dimethyl-3-nitro |
| N',N'-dimethyl-3-nitroaniline |
| 1-(Dimethylamino)-3-nitrobenzene |
