Introduction：Basic information about CAS 39053-41-3|2-methyl-3-nitrobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-3-nitrobenzoyl chloride |
|---|
| CAS Number | 39053-41-3 | Molecular Weight | 199.59100 |
|---|
| Density | 1.386g/cm3 | Boiling Point | 286.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 127.2ºC |
|---|
Names
| Name | 2-methyl-3-nitrobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.386g/cm3 |
|---|
| Boiling Point | 286.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3 |
|---|
| Molecular Weight | 199.59100 |
|---|
| Flash Point | 127.2ºC |
|---|
| Exact Mass | 199.00400 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.80540 |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | UENLNPJRTOHQIC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C(=O)Cl)cccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-methyl-3-nitro-benzoyl chloride |
| 2-methyl-3-nitrobenzoic acid chloride |
| 3-nitro-2-methyl-benzoylchloride |
| 3-nitro-2-methylbenzoic acid chloride |
| 2-Methyl-3-nitro-benzoylchlorid |
