Introduction：Basic information about CAS 363-32-6|Ethyl 2-fluoro-4-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 2-fluoro-4-nitrobenzoate |
|---|
| CAS Number | 363-32-6 | Molecular Weight | 213.163 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 326.2±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 151.1±25.1 °C |
|---|
Names
| Name | ethyl 2-fluoro-4-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 326.2±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8FNO4 |
|---|
| Molecular Weight | 213.163 |
|---|
| Flash Point | 151.1±25.1 °C |
|---|
| Exact Mass | 213.043732 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 1.98 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | KGLJHQMYPYCYCR-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])cc1F |
|---|
Synonyms
| 2-fluoro-4-nitro-benzoic acid ethyl ester |
| 2-Fluor-4-nitro-benzoesaeure-aethylester |
| Benzoic acid, 2-fluoro-4-nitro-, ethyl ester |
| ethyl 2-fluoranyl-4-nitro-benzoate |
| FD7341 |
| Ethyl 2-fluoro-4-nitrobenzoate |
