Introduction：Basic information about CAS 313644-24-5|4-butoxy-3-nitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-butoxy-3-nitroaniline |
|---|
| CAS Number | 313644-24-5 | Molecular Weight | 210.23000 |
|---|
| Density | 1.187g/cm3 | Boiling Point | 380.9ºC at 760mmHg |
|---|
| Molecular Formula | C10H14N2O3 | Melting Point | 60-64ºC |
|---|
| MSDS | / | Flash Point | 184.1ºC |
|---|
Names
| Name | 4-butoxy-3-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.187g/cm3 |
|---|
| Boiling Point | 380.9ºC at 760mmHg |
|---|
| Melting Point | 60-64ºC |
|---|
| Molecular Formula | C10H14N2O3 |
|---|
| Molecular Weight | 210.23000 |
|---|
| Flash Point | 184.1ºC |
|---|
| Exact Mass | 210.10000 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 3.46030 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | XOQGCSUIKIRRRV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(N)cc1[N+](=O)[O-] |
|---|
Synonyms
| 4-butoxy-3-nitrophenylamine |
| MFCD01320679 |
| Benzenamine,4-butoxy-3-nitro |
