Introduction：Basic information about CAS 139-28-6|m-(Benzoyloxy)acetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-(Benzoyloxy)acetophenone |
|---|
| CAS Number | 139-28-6 | Molecular Weight | 240.25400 |
|---|
| Density | 1.175 g/cm3 | Boiling Point | 392ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.8ºC |
|---|
Names
| Name | (3-acetylphenyl) benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.175 g/cm3 |
|---|
| Boiling Point | 392ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12O3 |
|---|
| Molecular Weight | 240.25400 |
|---|
| Flash Point | 174.8ºC |
|---|
| Exact Mass | 240.07900 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 3.10840 |
|---|
| Vapour Pressure | 2.37E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | CCDOBBGYSDWGKY-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cccc(OC(=O)c2ccccc2)c1 |
|---|
Synonyms
| 3-Acetylphenylbenzoat |
| benzoic acid (3-acetylphenyl)ester |
| 1-(3-Benzoyloxy-phenyl)-aethanon |
| m-(Benzoyloxy)acetophenone |
| 3'-Hydroxyacetophenone,benzoate |
| 3-acetylphenyl benzoate |
| Benzoesaeure-<3-acetyl-phenylester> |
| 1-(3-benzoyloxy-phenyl)-ethanone |
