Introduction：Basic information about CAS 1359833-28-5|3-Phenyl-9-phenylcarbazole-6-Boronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Phenyl-9-phenylcarbazole-6-Boronic acid pinacol ester |
|---|
| CAS Number | 1359833-28-5 | Molecular Weight | 445.36000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C30H28BNO2 | Melting Point | 162.0 to 166.0 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3,9-Diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 162.0 to 166.0 °C |
|---|
| Molecular Formula | C30H28BNO2 |
|---|
| Molecular Weight | 445.36000 |
|---|
| Exact Mass | 445.22100 |
|---|
| PSA | 23.39000 |
|---|
| LogP | 6.74990 |
|---|
| InChIKey | QVMVGEABPNCFOY-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OB(c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccccc2)OC1(C)C |
|---|
Synonyms
| 3-Phenyl-9-phenylcarbazole-6-Boronic acid pinacol ester |
