Introduction:Basic information about CAS 25683-09-4|S-Tritylcysteine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | S-Tritylcysteine |
|---|
| CAS Number | 25683-09-4 | Molecular Weight | 363.473 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 524.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H21NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.2±30.1 °C |
|---|
Names
| Name | D-cysteine-S-trityl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 524.7±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C22H21NO2S |
|---|
| Molecular Weight | 363.473 |
|---|
| Flash Point | 271.2±30.1 °C |
|---|
| Exact Mass | 363.129303 |
|---|
| PSA | 88.62000 |
|---|
| LogP | 5.56 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | DLMYFMLKORXJPO-UHFFFAOYSA-N |
|---|
| SMILES | NC(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
|---|
Synonyms
| Cysteine, S-(triphenylmethyl)- |
| (R)-2-amino-3-(tritylthio)propanoic acid |
| (S)-trityl-D-cysteine |
| S-trityl D-cysteine |
| S-Tritylcysteine |
| S-trityl-(R)-cysteine |