Introduction：Basic information about CAS 1346598-72-8|2-(tert-Butylamino)-3’, 4’-Dichloropropiophonone HCl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(tert-Butylamino)-3’, 4’-Dichloropropiophonone HCl |
|---|
| CAS Number | 1346598-72-8 | Molecular Weight | 310.647 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H18ClNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(tert-Butylamino)-3’, 4’-Dichloropropiophonone HCl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H18ClNO |
|---|
| Molecular Weight | 310.647 |
|---|
| Exact Mass | 309.045410 |
|---|
| InChIKey | YFAPNLTUNVYSBO-UHFFFAOYSA-N |
|---|
| SMILES | CC(NC(C)(C)C)C(=O)c1ccc(Cl)c(Cl)c1.Cl |
|---|
Synonyms
| 1-(3,4-Dichlorophenyl)-2-[(2-methyl-2-propanyl)amino]-1-propanone hydrochloride (1:1) |
| 6-(3-Chlorophenyl)-6-hydroxy-5-Methyl-3-thioMorpholine Carboxylic Acid (Mixture of DiastereoMers) |
| Bupropion IMpurity |
| 3,4-Dichloro Bupropion Hydrochloride |
| 1-Propanone, 1-(3,4-dichlorophenyl)-2-[(1,1-dimethylethyl)amino]-, hydrochloride (1:1) |
