Introduction：Basic information about CAS 1313613-18-1|N-[4-(3-oxo-4-Morpholinyl)phenyl]carbaMic acid phenylMethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[4-(3-oxo-4-Morpholinyl)phenyl]carbaMic acid phenylMethyl ester |
|---|
| CAS Number | 1313613-18-1 | Molecular Weight | 326.346 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 549.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 286.0±30.1 °C |
|---|
Names
| Name | [4-(3-oxo-morpholin-4-yl)phenyl]carbamic acid benzyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 549.3±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H18N2O4 |
|---|
| Molecular Weight | 326.346 |
|---|
| Flash Point | 286.0±30.1 °C |
|---|
| Exact Mass | 326.126648 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 1.37 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | GNEOLGPJVCVBRF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Nc1ccc(N2CCOCC2=O)cc1)OCc1ccccc1 |
|---|
Synonyms
| [4-(3-Oxo-morpholin-4-yl)-phenyl]-carbamic acid benzyl ester |
| benzyl 4-(3-oxomorpholin-4-yl)phenylcarbamate |
| Carbamic acid, N-[4-(3-oxo-4-morpholinyl)phenyl]-, phenylmethyl ester |
| Benzyl [4-(3-oxo-4-morpholinyl)phenyl]carbamate |
| N-[4-(3-oxo-4-Morpholinyl)phenyl]carbaMic acid phenylMethyl ester |
| benzyl (4-(3-oxomorpholin)phenyl)carbamate |
| N-[4-(3-oxo-4-Morpholinyl)phenyl]carbaMic acid phenylMethyl ester |
| Rivaroxaban Impurity 67 |
