Introduction：Basic information about CAS 1365692-79-0|4-boric acid pinacol ester-9,9-dimethyl fluorene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-boric acid pinacol ester-9,9-dimethyl fluorene |
|---|
| CAS Number | 1365692-79-0 | Molecular Weight | 320.233 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 443.1±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H25BO2 | Melting Point | 143 °C |
|---|
| MSDS | / | Flash Point | 221.8±22.9 °C |
|---|
Names
| Name | 2-(9,9-Dimethyl-9H-fluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 443.1±24.0 °C at 760 mmHg |
|---|
| Melting Point | 143 °C |
|---|
| Molecular Formula | C21H25BO2 |
|---|
| Molecular Weight | 320.233 |
|---|
| Flash Point | 221.8±22.9 °C |
|---|
| Exact Mass | 320.194763 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.29210 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | OIPUMEUHUKJHRJ-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)c2ccccc2-c2c(B3OC(C)(C)C(C)(C)O3)cccc21 |
|---|
Synonyms
| 2-(9,9-Dimethyl-9H-fluoren-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 1,3,2-Dioxaborolane, 2-(9,9-dimethyl-9H-fluoren-4-yl)-4,4,5,5-tetramethyl- |
| 4-boric acid pinacol ester-9,9-dimethyl fluorene |
