Introduction：Basic information about CAS 130719-30-1|N-(p-Toluenesulfonyl)-2-pyrroline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(p-Toluenesulfonyl)-2-pyrroline |
|---|
| CAS Number | 130719-30-1 | Molecular Weight | 223.291 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 354.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.4±28.7 °C |
|---|
Names
| Name | 1-(toluene-4-sulfonyl)-2,3-dihydro-1H-pyrrole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 354.9±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13NO2S |
|---|
| Molecular Weight | 223.291 |
|---|
| Flash Point | 168.4±28.7 °C |
|---|
| Exact Mass | 223.066696 |
|---|
| PSA | 45.76000 |
|---|
| LogP | 3.10 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XYMRZTIWXWDRCG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2C=CCC2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| 1-tosyl-2,3-dihydro-1H-pyrrole |
| 1-Tosyl-2,3-dihydropyrrole |
| 1-(toluene-4-sulfonyl)-2,3-dihydro-pyrrole |
| 1-(Toluene-4-sulfonyl)-2,3-dihydro-1H-pyrrole |
| 1-(toluene-4-sulphonyl)-pyrroline |
| N-p-toluenesulfonyl-2,3-dihydropyrrole |
| 2,3-dihydro-1-tosyl-1H-pyrrole |
| 1H-Pyrrole, 2,3-dihydro-1-[(4-methylphenyl)sulfonyl]- |
| 1-[(4-Methylphenyl)sulfonyl]-2,3-dihydro-1H-pyrrole |
