Introduction：Basic information about CAS 13132-09-7|8-Oxo-8H-indeno[2,1-b]thiophene-2-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-Oxo-8H-indeno[2,1-b]thiophene-2-carboxylic acid |
|---|
| CAS Number | 13132-09-7 | Molecular Weight | 230.239 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 492.1±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H6O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.4±25.4 °C |
|---|
Names
| Name | 8-Oxo-8H-indeno<2,1-b>thiophen-2-carbonsaeure |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 492.1±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H6O3S |
|---|
| Molecular Weight | 230.239 |
|---|
| Flash Point | 251.4±25.4 °C |
|---|
| Exact Mass | 230.003769 |
|---|
| PSA | 82.61000 |
|---|
| LogP | 2.93 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.740 |
|---|
| InChIKey | BJDHZRXTDAKQCG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc2c(s1)C(=O)c1ccccc1-2 |
|---|
Synonyms
| 8-Oxo-8H-indeno<2.1-b>thiophen-2-carbonsaeure |
| 8-Oxo-8H-indeno[2,1-b]thiophene-2-carboxylic acid |
| 8-Oxo-8H-indeno[2.1-b]thiophen-2-carbonsaeure |
| 8H-Indeno[2,1-b]thiophene-2-carboxylic acid, 8-oxo- |
