Introduction：Basic information about CAS 1365267-35-1|Rivaroxaban Urea Dimer Impurity, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rivaroxaban Urea Dimer Impurity |
|---|
| CAS Number | 1365267-35-1 | Molecular Weight | 608.599 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 993.6±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C29H32N6O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 554.7±34.3 °C |
|---|
Names
| Name | 1,3-Bis({(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-1,3-oxazolidin-5-yl}methyl)urea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 993.6±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C29H32N6O9 |
|---|
| Molecular Weight | 608.599 |
|---|
| Flash Point | 554.7±34.3 °C |
|---|
| Exact Mass | 608.223083 |
|---|
| LogP | -0.52 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | RMYVVSKNFAMRGJ-ZEQRLZLVSA-N |
|---|
| SMILES | O=C(NCC1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1)NCC1CN(c2ccc(N3CCOCC3=O)cc2)C(=O)O1 |
|---|
Synonyms
| Urea, N,N'-bis[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]- |
| 1,3-Bis({(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-1,3-oxazolidin-5-yl}methyl)urea |
| N,N'-Bis[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]urea |
| Rivaroxaban Urea Dimer Impurity |
| Rivaroxaban Impurity 1 |
