CAS 139051-27-7|Anemarsaponin B
Introduction：Basic information about CAS 139051-27-7|Anemarsaponin B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Anemarsaponin B | ||
|---|---|---|---|
| CAS Number | 139051-27-7 | Molecular Weight | 903.058 |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1023.7±65.0 °C at 760 mmHg |
| Molecular Formula | C45H74O18 | Melting Point | / |
| MSDS | / | Flash Point | 572.9±34.3 °C |
Names
| Name | (3β,5β,25S)-26-(β-D-Glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
|---|---|
| Synonym | More Synonyms |
Anemarsaponin B BiologicalActivity
| Description | Anemarsaponin B is a steroidal saponin isolated from the rhizomes of A. asphodeloides (Liliaceae). Anemarsaponin B decreases the protein and mRNA levels of iNOS and COX-2. Anemarsaponin B reduces the expressions and productions of pro-inflammatory cytokines, including TNF-a and IL-6. Anemarsaponin B inhibits the nuclear translocation of the p65 subunit of NF-κB by blocking the phosphorylation of IκBα. Anemarsaponin B also inhibits the phosphorylation of MAP kinase kinases 3/6 (MKK3/6) and mixed lineage kinase 3 (MLK3). Anti-inflammatory effect [1]. |
|---|---|
| Related Catalog | Signaling Pathways >>Immunology/Inflammation >>NO SynthaseResearch Areas >>Inflammation/ImmunologySignaling Pathways >>Immunology/Inflammation >>COX |
| Target | COX-2 p65 iNOS |
| References | [1]. Kim JY, et al. Anti-inflammatory effect of anemarsaponin B isolated from the rhizomes of Anemarrhena asphodeloides in LPS-induced RAW 264.7 macrophages is mediated by negative regulation of the nuclear factor-kappaB and p38 pathways. Food Chem Toxicol. 2009 Jul;47(7):1610-7. |
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1023.7±65.0 °C at 760 mmHg |
| Molecular Formula | C45H74O18 |
| Molecular Weight | 903.058 |
| Flash Point | 572.9±34.3 °C |
| Exact Mass | 902.487488 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | ROHLIYKWVMBBFX-UHFFFAOYSA-N |
| SMILES | CC1=C(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CCC5CC(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C12 |
Synonyms
| (3β,5β)-26-(β-D-Glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| β-D-Galactopyranoside, (3β,5β,25S)-26-(β-D-glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl- |
| (3β,5β,25S)-26-(β-D-Glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| β-D-Galactopyranoside, (3β,5β)-26-(β-D-glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl- |
| Anemarsaponin B |
