Introduction：Basic information about CAS 130-59-6|8-nitronaphth[1,2-d][1,2,3]oxadiazole-5-sulphonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 8-nitronaphth[1,2-d][1,2,3]oxadiazole-5-sulphonic acid |
|---|
| CAS Number | 130-59-6 | Molecular Weight | 295.228 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H5N3O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 8-nitronaphth[1,2-d][1,2,3]oxadiazole-5-sulphonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Molecular Formula | C10H5N3O6S |
|---|
| Molecular Weight | 295.228 |
|---|
| Exact Mass | 294.989899 |
|---|
| LogP | 0.60 |
|---|
| Index of Refraction | 1.758 |
|---|
| InChIKey | SQHJNWIFJGDCQA-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2c(S(=O)(=O)O)cc3onnc3c2c1 |
|---|
Synonyms
| EINECS 204-991-2 |
| 8-Nitronaphtho[1,2-d][1,2,3]oxadiazole-5-sulfonic acid |
| Naphth[1,2-d][1,2,3]oxadiazole-5-sulfonic acid, 8-nitro- |
