Introduction：Basic information about CAS 1353987-25-3|3-Methyl-thiophene-2-carboxylic acid piperidin-3-ylamide hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methyl-thiophene-2-carboxylic acid piperidin-3-ylamide hydrochloride |
|---|
| CAS Number | 1353987-25-3 | Molecular Weight | 260.78348 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 397.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17ClN2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.0±27.9 °C |
|---|
Names
| Name | 3-Methyl-thiophene-2-carboxylic acid piperidin-3-ylamide hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 397.2±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17ClN2OS |
|---|
| Molecular Weight | 260.78348 |
|---|
| Flash Point | 194.0±27.9 °C |
|---|
| Exact Mass | 224.098328 |
|---|
| LogP | 1.41 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | DYTYGFNIPDMBQQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccsc1C(=O)NC1CCCNC1.Cl |
|---|
Synonyms
| 2-Thiophenecarboxamide, 3-methyl-N-3-piperidinyl- |
| MFCD18330229 |
| 3-Methyl-N-(3-piperidinyl)-2-thiophenecarboxamide |
