Introduction：Basic information about CAS 1308292-89-8|Chlorhexidine Impurity B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chlorhexidine Impurity B |
|---|
| CAS Number | 1308292-89-8 | Molecular Weight | 395.890 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H26ClN9O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Chlorhexidine Impurity B |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C16H26ClN9O |
|---|
| Molecular Weight | 395.890 |
|---|
| Exact Mass | 395.194885 |
|---|
| LogP | 0.93 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | LATUPHDTTULFOL-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)NC(N)=NCCCCCCN=C(N)N=C(N)Nc1ccc(Cl)cc1 |
|---|
Synonyms
| N-[6-(N'-Carbamoylcarbamimidamido)hexyl]-N'-(4-chlorophenyl)imidodicarbonimidic diamide |
| Imidodicarbonimidic diamide, N-[6-[[[(aminocarbonyl)amino]iminomethyl]amino]hexyl]-N'-(4-chlorophenyl)- |
