Introduction：Basic information about CAS 1334378-48-1|SulfadiMethoxine-13C6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | SulfadiMethoxine-13C6 |
|---|
| CAS Number | 1334378-48-1 | Molecular Weight | 316.285 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C613C6H14N4O4S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | SulfadiMethoxine-13C6 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C613C6H14N4O4S |
|---|
| Molecular Weight | 316.285 |
|---|
| Exact Mass | 316.093689 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | ZZORFUFYDOWNEF-CICUYXHZSA-N |
|---|
| SMILES | COc1cc(NS(=O)(=O)c2ccc(N)cc2)nc(OC)n1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H317-H319-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38-43 |
|---|
| Safety Phrases | 26-36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-Amino-N-(2,6-dimethoxy-4-pyrimidinyl)benzene-13C6-sulfonamide |
| Benzene-1,2,3,4,5,6-13C6-sulfonamide, 4-amino-N-(2,6-dimethoxy-4-pyrimidinyl)- |
| Sulfadimethoxine-(phenyl-13C6) |
| MFCD00145341 |
| 4-Amino-N-(2,6-dimethoxy-4-pyrimidinyl)(13C6)benzenesulfonamide |
