Introduction:Basic information about CAS 134108-76-2|[(1R,2R)-2-Hydroxycyclohexyl]carbamic Acid Phenylmethyl Ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [(1R,2R)-2-Hydroxycyclohexyl]carbamic Acid Phenylmethyl Ester |
|---|
| CAS Number | 134108-76-2 | Molecular Weight | 249.30556 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H19NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [(1R,2R)-2-hydroxycyclohexyl]CarbaMic acidphenylMethyl ester |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H19NO3 |
|---|
| Molecular Weight | 249.30556 |
|---|
| Appearance of Characters | Powder |
|---|
| InChIKey | IDQLGJJPYSFXPM-CHWSQXEVSA-N |
|---|
| SMILES | O=C(NC1CCCCC1O)OCc1ccccc1 |
|---|