Introduction：Basic information about CAS 1616760-97-4|Tofacitinib Impurity 2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tofacitinib Impurity 2 |
|---|
| CAS Number | 1616760-97-4 | Molecular Weight | 279.768 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H18ClN5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Tofacitinib Impurity 2 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C13H18ClN5 |
|---|
| Molecular Weight | 279.768 |
|---|
| Exact Mass | 279.125061 |
|---|
| LogP | 2.81 |
|---|
| Index of Refraction | 1.643 |
|---|
| InChIKey | HXKHQCADGODNAT-SCZZXKLOSA-N |
|---|
| SMILES | CC1CCNCC1N(C)c1nc(Cl)nc2[nH]ccc12 |
|---|
Synonyms
| 7H-Pyrrolo[2,3-d]pyrimidin-4-amine, 2-chloro-N-methyl-N-[(3R,4R)-4-methyl-3-piperidinyl]- |
| 2-Chloro-N-methyl-N-[(3R,4R)-4-methyl-3-piperidinyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
