Introduction:Basic information about CAS 16463-84-6|21-Chloro-9-fluoro-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione cyclic 16,17-ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 21-Chloro-9-fluoro-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione cyclic 16,17-acetal with acetophenone |
|---|
| CAS Number | 16463-84-6 | Molecular Weight | 517.0 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C29H34ClFO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 21-Chloro-9-fluoro-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione cyclic 16,17-acetal with acetophenone |
|---|
Chemical & Physical Properties
| Molecular Formula | C29H34ClFO5 |
|---|
| Molecular Weight | 517.0 |
|---|
| InChIKey | LVXSYNQPGNAMAJ-ZPHQKVKWSA-N |
|---|
| SMILES | CC1(c2ccccc2)OC2CC3C4CCC5=CC(=O)CCC5(C)C4(F)C(O)CC3(C)C2(C(=O)CCl)O1 |
|---|