Introduction:Basic information about CAS 1373318-85-4|2'-Dihydro Boceprevir-d9 (Boceprevir Metabolite M28-d9+M31-d9 (Mixture of Diast, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-Dihydro Boceprevir-d9 (Boceprevir Metabolite M28-d9+M31-d9 (Mixture of Diastereomers)) |
|---|
| CAS Number | 1373318-85-4 | Molecular Weight | 530.7 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C27H47N5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2'-Dihydro Boceprevir-d9 (Boceprevir Metabolite M28-d9+M31-d9 (Mixture of Diastereomers)) |
|---|
Chemical & Physical Properties
| Molecular Formula | C27H47N5O5 |
|---|
| Molecular Weight | 530.7 |
|---|
| InChIKey | FEBWCINGHXXUCV-AWQZEPEUSA-N |
|---|
| SMILES | CC(C)(C)NC(=O)NC(C(=O)N1CC2C(C1C(=O)NC(CC1CCC1)C(O)C(N)=O)C2(C)C)C(C)(C)C |
|---|