Introduction:Basic information about CAS 39311-74-5|(4-Chloro-2-methylphenoxy)acetic acid sodium salt mixt. with N-(3,4-dichlorophenyl)pr, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-Chloro-2-methylphenoxy)acetic acid sodium salt mixt. with N-(3,4-dichlorophenyl)propanamide |
|---|
| CAS Number | 39311-74-5 | Molecular Weight | 440.7 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H17Cl3NNaO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (4-Chloro-2-methylphenoxy)acetic acid sodium salt mixt. with N-(3,4-dichlorophenyl)propanamide |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H17Cl3NNaO4 |
|---|
| Molecular Weight | 440.7 |
|---|
| InChIKey | BBTZAVCSVGPTLN-UHFFFAOYSA-M |
|---|
| SMILES | CCC(=O)Nc1ccc(Cl)c(Cl)c1.Cc1cc(Cl)ccc1OCC(=O)[O-].[Na+] |
|---|