Introduction:Basic information about CAS 61952-98-5|6-Chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine mixt. with N-ethyl-6-methoxy-N, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine mixt. with N-ethyl-6-methoxy-N'-(1-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|
| CAS Number | 61952-98-5 | Molecular Weight | 426.9 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C17H31ClN10O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-Chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine mixt. with N-ethyl-6-methoxy-N'-(1-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|
Chemical & Physical Properties
| Molecular Formula | C17H31ClN10O |
|---|
| Molecular Weight | 426.9 |
|---|
| InChIKey | WZEYLYNXPJAOOC-UHFFFAOYSA-N |
|---|
| SMILES | CCNc1nc(Cl)nc(NCC)n1.CCNc1nc(NC(C)CC)nc(OC)n1 |
|---|