Introduction：Basic information about CAS 130987-46-1|Pyrazinoic acid, alpha-ester with chloramphenicol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pyrazinoic acid, alpha-ester with chloramphenicol |
|---|
| CAS Number | 130987-46-1 | Molecular Weight | 429.2 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H14Cl2N4O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Pyrazinoic acid, alpha-ester with chloramphenicol |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H14Cl2N4O6 |
|---|
| Molecular Weight | 429.2 |
|---|
| InChIKey | YBIAGWWKQKHOPF-CHWSQXEVSA-N |
|---|
| SMILES | O=C(OCC(NC(=O)C(Cl)Cl)C(O)c1ccc([N+](=O)[O-])cc1)c1cnccn1 |
|---|
