Introduction:Basic information about CAS 39389-88-3|Phenol, 2,3,4,5,6-pentachloro-mixt. with 2,3,4,6-tetrachlorophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phenol, 2,3,4,5,6-pentachloro-mixt. with 2,3,4,6-tetrachlorophenol |
|---|
| CAS Number | 39389-88-3 | Molecular Weight | 498.2 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H3Cl9O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Phenol, 2,3,4,5,6-pentachloro-mixt. with 2,3,4,6-tetrachlorophenol |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H3Cl9O2 |
|---|
| Molecular Weight | 498.2 |
|---|
| InChIKey | FWXXNRXPXRWDEA-UHFFFAOYSA-N |
|---|
| SMILES | Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.Oc1c(Cl)cc(Cl)c(Cl)c1Cl |
|---|