Introduction：Basic information about 1,2-Bis(3-methylphenoxy)ethane CAS 54914-85-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,2-Bis(3-methylphenoxy)ethane Basic information
| Product Name: | 1,2-Bis(3-methylphenoxy)ethane |
| Synonyms: | 1,1'-[1,2-ethanediylbis(oxy)]bis[3-methyl-benzen;3,3'-(Ethylenebisoxy)bistoluene;1,2-Bis(3-methylphenoxy)ethane;Ethylene glycol M-tolyl ether (EGTE);1,2-Bis(3-Methylphenyloxy)ethane;Ethylene Glycol Di(m-tolyl) Ether;F-203(EGTE);1,2-Bis(3-methylphenoxy)ethane(EGTE) |
| CAS: | 54914-85-1 |
| MF: | C16H18O2 |
| MW: | 242.31 |
| EINECS: | 402-730-9 |
| Product Categories: | API intermediates |
| Mol File: | 54914-85-1.mol |
|
1,2-Bis(3-methylphenoxy)ethane Chemical Properties
| Melting point | 96.0 to 100.0 °C |
| Boiling point | 381.8±30.0 °C(Predicted) |
| density | 1.049±0.06 g/cm3(Predicted) |
| vapor pressure | 0.001-0.004Pa at 25-45.5℃ |
| solubility | Chloroform (Slightly), Methanol (Very Slightly) |
| form | Solid:particulate/powder |
| color | White to Light yellow |
| InChI | InChI=1S/C16H18O2/c1-13-5-3-7-15(11-13)17-9-10-18-16-8-4-6-14(2)12-16/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | OAGNKYSIOSDNIG-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=CC(C)=C1)COC1=CC=CC(C)=C1 |
| LogP | 3.94 at 21℃ |
| Surface tension | 72.6mN/m at 400μg/L and 20℃ |
| EPA Substance Registry System | Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[3-methyl- (54914-85-1) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9/PG III |
| TSCA | TSCA listed |
| HS Code | 2909.30.6000 |
| HazardClass | 9 |
| PackingGroup | III |
1,2-Bis(3-methylphenoxy)ethane Usage And Synthesis
| Uses | 1,2-Bis(m-tolyloxy)ethane can be used for its agonistic effects of diverse xenobiotics on the constitutive androstane receptor as detected in a recombinant yeast-?cell assay |
| General Description | In a thermal recording medium including a basic chromogenic dye, a developer and a sensitizer, a composition for a thermal recording medium which composition contains 50 ppm to 5.0 mass % of 1-(3-methylphenoxy)-2-(4-methylphenoxy)ethane and/or 1,2-bis(4-methylphenoxy)ethane in 1,2-bis(3-methylphenoxy)ethane is used as a said sensitizer, whereby the 1,2-bis(3-methylphenoxy)ethane compound is remarkably improved in milling property in the preparation of the above sensitizer, and a thermal recording medium is provided without impairing the colourability, etc., such as thermal colorability. Generally, as raw materials, 1,2-bis(3-methylphenoxy)ethane is synthesized from 3-methylphenol and 1,2-dihalogenoethane or the like and then purified by recrystallization. |
1,2-Bis(3-methylphenoxy)ethane Preparation Products And Raw materials
| Preparation Products | 3-Hydroxy-2-naphthoic acid |
