Introduction:Basic information about 2-(1,1-Dimethylpropyl)anthraquinone CAS 32588-54-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-(1,1-Dimethylpropyl)anthraquinone Basic information
| Product Name: | 2-(1,1-Dimethylpropyl)anthraquinone |
| Synonyms: | 2-(1,1-dimethylpropyl)anthraquinone;2-TERT-PENTYLANTHRAQUINONE;2-tert-Amylanthraquinone;9,10-ANTHRACENEDIONE, 2-(1,1-DIMETHYLPROPYL)-;potassium 2-[2-[hydroxy(mercapto)phosphino]oxyethylamino]-2-oxoethanethiolate;10-Anthracenedione,2-(1,1-dimethylpropyl)-9;2-(1,1-dimethylpropyl)-10-anthracenedione;2-(1,1-Dimethylpropyl)-9,10-anthraquinone |
| CAS: | 32588-54-8 |
| MF: | C19H18O2 |
| MW: | 278.35 |
| EINECS: | 251-116-5 |
| Product Categories: | |
| Mol File: | 32588-54-8.mol |
|
2-(1,1-Dimethylpropyl)anthraquinone Chemical Properties
| Melting point | 60-65°C |
| Boiling point | 245-273 °C |
| density | 0.82 g/cm3 |
| Fp | 222°C |
| storage temp. | Sealed in dry,Room Temperature |
| InChI | InChI=1S/C19H18O2/c1-4-19(2,3)12-9-10-15-16(11-12)18(21)14-8-6-5-7-13(14)17(15)20/h5-11H,4H2,1-3H3 |
| InChIKey | WUKWGUZTPMOXOW-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1C(C)(C)CC |
| CAS DataBase Reference | 32588-54-8(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 2-(1,1-dimethylpropyl)- (32588-54-8) |
Safety Information
2-(1,1-Dimethylpropyl)anthraquinone Usage And Synthesis
2-(1,1-Dimethylpropyl)anthraquinone Preparation Products And Raw materials