Introduction：Basic information about 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid CAS 69806-34-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Basic information
| Product Name: | 2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid |
| Synonyms: | HALOXYFOP;2-[4-[3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL]OXYPHENOXY]PROPANOIC ACID;2-[4-(3-CHLORO-5-TRIFLUOROMETHYL-2-PYRIDYLOXY)PHENOXY]PROPIONIC ACID;ethoxyethyl(RS)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionic acid;ethyl(RS)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionic acid;(±)2-(4-(3-chloro-5-trifluoromehtyl-2-pyridyloxy)phenoxy)propionic acid;(RS)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionic acid;Haloxyfop Solution, 1000ppm |
| CAS: | 69806-34-4 |
| MF: | C15H11ClF3NO4 |
| MW: | 361.7 |
| EINECS: | |
| Product Categories: | HA -HTPesticides&Metabolites;Alpha sort;Baby Food Directives 13/2003 EC&14/2003 ECPesticides&Metabolites;European Community: ISO and DIN;H;Herbicides;H-MAlphabetic;Method Specific;Phenoxy structure |
| Mol File: | 69806-34-4.mol |
|
2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Chemical Properties
| Melting point | 107.5 °C |
| Boiling point | 420.3±45.0 °C(Predicted) |
| density | 1.442±0.06 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | DMSO : 100 mg/mL (276.47 mM; Need ultrasonic) |
| form | Solid |
| pka | 3.12±0.10(Predicted) |
| color | White to off-white |
| BRN | 1507817 |
| Major Application | agriculture
environmental |
| InChI | 1S/C15H11ClF3NO4/c1-8(14(21)22)23-10-2-4-11(5-3-10)24-13-12(16)6-9(7-20-13)15(17,18)19/h2-8H,1H3,(H,21,22) |
| InChIKey | GOCUAJYOYBLQRH-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Oc2ncc(cc2Cl)C(F)(F)F)cc1)C(O)=O |
| CAS DataBase Reference | 69806-34-4(CAS DataBase Reference) |
| EPA Substance Registry System | Haloxyfop (69806-34-4) |
Safety Information
| WGK Germany | 3 |
| RTECS | UA2458284 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Eye Dam. 1 |
2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Usage And Synthesis
| Uses | (±)-Haloxyfop is a herbicide. |
| Definition | ChEBI: 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid is a monocarboxylic acid that is 2-phenoxypropanoic acid in which the hydrogen at the para position of the phenyl ring has been replaced by a [3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy group. It is a member of pyridines, an aromatic ether, a monocarboxylic acid, an organofluorine compound and an organochlorine compound. |
2-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Preparation Products And Raw materials
| Raw materials | Methyl 2-(4-((3-chloro-5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoate |
