Introduction：Basic information about 2-Amino-2'-fluoro-5-bromobenzophenone CAS 1479-58-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Amino-2'-fluoro-5-bromobenzophenone Basic information
| Product Name: | 2-Amino-2'-fluoro-5-bromobenzophenone |
| Synonyms: | 2-Amino-2'-fluoro-5-bromobenzophenone,98%;(2-AMINO-5-BROMO-PHENYL)-(2-FLUORO-PHENYL)-METHANONE;Methanone, (2-amino-5-bromophenyl)(2-fluorophenyl)-;4-chlorobenzenesulfinate;2-Amino-5-bromo-2zzhlxy-fluorobenzophenone;(2-Amino-5-bromophenyl)(2-fluorophenyl)methanone, 4-Bromo-2-(2-fluorobenzoyl)aniline;2-Amino-2'-fluoro-5-bromobenzophenone;2-amino-5-bromo-2'-fluorobenzophenone |
| CAS: | 1479-58-9 |
| MF: | C13H9BrFNO |
| MW: | 294.12 |
| EINECS: | 216-037-2 |
| Product Categories: | Amines;Aromatics;API intermediates;Intermediates;Aromatic Benzophenones & Derivatives (substituted) |
| Mol File: | 1479-58-9.mol |
|
2-Amino-2'-fluoro-5-bromobenzophenone Chemical Properties
| Melting point | 100-104 °C |
| Boiling point | 450.9±45.0 °C(Predicted) |
| density | 1.5259 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -1.12±0.10(Predicted) |
| form | Solid |
| color | Yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C13H9BrFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| InChIKey | XCOKDXNGCQXFCV-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Br)=CC=C1N)(C1=CC=CC=C1F)=O |
| CAS DataBase Reference | 1479-58-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-5-bromo-2'-fluorobenzophenone(1479-58-9) |
Safety Information
| Safety Statements | 24/25 |
| HS Code | 29223990 |
2-Amino-2'-fluoro-5-bromobenzophenone Usage And Synthesis
| Chemical Properties | yellow powder |
| Uses | Intermeidate in the preparation of many GABA modulators |
2-Amino-2'-fluoro-5-bromobenzophenone Preparation Products And Raw materials
