2-Diphenylphosphinobenzaldehyde CAS 50777-76-9
Introduction：Basic information about 2-Diphenylphosphinobenzaldehyde CAS 50777-76-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Diphenylphosphinobenzaldehyde Basic information
| Product Name: | 2-Diphenylphosphinobenzaldehyde |
| Synonyms: | Diphenylphosphinobenzaldehyde;(2-Formylphenyl)diphenylphosphine;o-(Diphenylphosphino)benzaldehyde;2-DiphenylphosphiNAbenzaldehyde;2- twophenylphosphinebenzaldehyde;2-(Diphenylphosphino)benzaldehyde, min. 97%;2-Diphenylphosphinobenzaldehyde（DPPBde）;2-(DIPHENYLPHOSPHINO)BENZALDEHYDE |
| CAS: | 50777-76-9 |
| MF: | C19H15OP |
| MW: | 290.3 |
| EINECS: | |
| Product Categories: | Aldehydes;Building Blocks;C13-C60;Carbonyl Compounds;Catalysis and Inorganic Chemistry;Chemical Synthesis;Organic Building Blocks;Phosphine Ligands;Phosphorus Compounds;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds;phosphine ligand |
| Mol File: | 50777-76-9.mol |
2-Diphenylphosphinobenzaldehyde Chemical Properties
| Melting point | 112-115 °C(lit.) |
| Boiling point | 417.4±28.0 °C(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Yellow |
| λmax | 376nm(CH2Cl2)(lit.) |
| InChI | InChI=1S/C19H15OP/c20-15-16-9-7-8-14-19(16)21(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15H |
| InChIKey | DRCPJRZHAJMWOU-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 50777-76-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Uses | suzuki reaction |
| Synthesis Reference(s) | Synthetic Communications, 22, p. 1453, 1992 DOI: 10.1080/00397919208021613 |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
2-Diphenylphosphinobenzaldehyde Preparation Products And Raw materials
| Raw materials | Phosphine, [2-(1,3-dioxolan-2-yl)phenyl]diphenyl--->Phosphine, diphenyl(trimethylstannyl)--->O-(DIPHENYLPHOSPHINO)BENZONITRILE-->2-BROMOPHENYLDIPHENYLPHOSPHINE-->2-(2-BROMOPHENYL)-1,3-DIOXOLANE-->N,N-DIETHYLBENZAMIDE-->Diphenylphosphine-->2-Bromobenzaldehyde-->2-Bromobenzonitrile-->Chlorodiphenylphosphine |
| Preparation Products | Diphenylphosphinostyrene-->[S(R)]-N-[(S)-[2-(Diphenylphosphino)phenyl]phenylmethyl]-2-methyl-2-propanesulfinamide |
