Introduction:Basic information about 2'-Hydroxy-3-phenylpropiophenone CAS 3516-95-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2'-Hydroxy-3-phenylpropiophenone Basic information
| Product Name: | 2'-Hydroxy-3-phenylpropiophenone |
| Synonyms: | 1-(2-HYDROXYPHENYL)-3-PHENYLPROPAN-1- ONE;1-(2-HYDROXYPHENYL)-3-PHENYLPROPANONE;2'-HYDROXY-3-PHENYLPROPIOPHENONE;2-HYDROXY-3-PHENYLPROPIOPHENONE;2-Hydroxyphenyl-3-Propiophenone;O-HYDROXY-BETA-PHENYL PROPIOPHENONE;2'-Hydroxydihydrochalcone;β-Phenyl-2-hydroxypropiophenone |
| CAS: | 3516-95-8 |
| MF: | C15H14O2 |
| MW: | 226.27 |
| EINECS: | 222-521-4 |
| Product Categories: | Metabolites & Impurities;Aromatics;C15 to C38;Carbonyl Compounds;Ketones |
| Mol File: | 3516-95-8.mol |
|
2'-Hydroxy-3-phenylpropiophenone Chemical Properties
| Melting point | 36-37 °C(lit.) |
| Boiling point | 158°C/2mmHg(lit.) |
| density | 1.150±0.06 g/cm3(Predicted) |
| refractive index | n20/D 1.5968(lit.) |
| Fp | >230 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Ethyl Acetate (Slightly) |
| pka | 8.07±0.30(Predicted) |
| form | Solid |
| color | Off-White |
| λmax | 324nm(MeOH)(lit.) |
| InChI | InChI=1S/C15H14O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-9,16H,10-11H2 |
| InChIKey | JCPGMXJLFWGRMZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1O)(=O)CCC1=CC=CC=C1 |
| CAS DataBase Reference | 3516-95-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanone, 1-(2-hydroxyphenyl)-3-phenyl- (3516-95-8) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
2'-Hydroxy-3-phenylpropiophenone Usage And Synthesis
| Chemical Properties | Slightly Yellow Crystals |
| Uses | 2’-Hydroxy-3-phenylpropiophenone (Propafenone EP Impurity A; Propafenone BP Impurity A; Propafenone USP Impurity A) is a metabolite of Propafenone (P757500). |
| General Description | 2′-Hydroxy-3-phenylpropiophenone is a colorless to yellow liquid or solid. 2′-Hydroxy-3-phenylpropiophenone derivatives show antiarrhythmic,spasmolytic and local anaesthetic activities. |
2'-Hydroxy-3-phenylpropiophenone Preparation Products And Raw materials
| Preparation Products | Propafenone Hydrochloride |