Introduction:Basic information about 2'-HYDROXY-4,4',6'-TRIMETHOXYCHALCONE CAS 3420-72-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2'-HYDROXY-4,4',6'-TRIMETHOXYCHALCONE Basic information
| Product Name: | 2'-HYDROXY-4,4',6'-TRIMETHOXYCHALCONE |
| Synonyms: | 1-(2-Hydroxy-4,6-diMethoxyphenyl)-3-(4-Methoxyphenyl)prop-2-en-1-one;FLAVOKAWAIN A;FLAVOKAWIN A;(E)-1-(2-HYDROXY-4,6-DIMETHOXYPHENYL)-3-(4-METHOXYPHENYL)PROP-2-EN-1-ONE;1-(2-HYDROXY-4,6-DIMETHOXYPHENYL)-3-(4-METHOXYPHENYL)-2-PROPEN-1-ONE;2'-Hydroxy-4,4',6'-trimethoxy;4-Methoxybenzylidene(4,6-dimethoxy-2-hydroxyacetophenone);(2E)-1-(2,4-Dimethoxy-6-hydroxyphenyl)-3-(4-methoxyphenyl)-2-propene-1-one |
| CAS: | 3420-72-2 |
| MF: | C18H18O5 |
| MW: | 314.33 |
| EINECS: | |
| Product Categories: | Chalcones;Plant Oils, Toxins, Phenolic Acids & Derivatives;Chemical Synthesis;Organic Building Blocks;C15 to C38;Carbonyl Compounds;Ketones;Building Blocks;C15 to C38;Carbonyl Compounds |
| Mol File: | 3420-72-2.mol |
|
2'-HYDROXY-4,4',6'-TRIMETHOXYCHALCONE Chemical Properties
| Melting point | 112-116 °C(lit.) |
| Boiling point | 529.9±50.0 °C(Predicted) |
| density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.78±0.40(Predicted) |
| color | Pale Yellow to Light Yellow |
| InChI | 1S/C18H18O5/c1-21-13-7-4-12(5-8-13)6-9-15(19)18-16(20)10-14(22-2)11-17(18)23-3/h4-11,20H,1-3H3/b9-6+ |
| InChIKey | CGIBCVBDFUTMPT-RMKNXTFCSA-N |
| SMILES | COc1ccc(\C=C\C(=O)c2c(O)cc(OC)cc2OC)cc1 |
| CAS DataBase Reference | 3420-72-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2914.50.3000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
2'-HYDROXY-4,4',6'-TRIMETHOXYCHALCONE Usage And Synthesis
| Chemical Properties | Pale yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the rhizome of Piper methysticum Forst. |
| Uses | 2′-Hydroxy-4,4′,6′-trimethoxychalcone may be used to synthesize 2′,2”′-dihydroxy-4,4′,4′′,4”′,6′,6′′′-hexamethoxy[5′,5′′′]bichalcone and 3′-bromo-4,4′,6′-trimethoxy-2′-hydroxychalcone. |
| Definition | ChEBI: Flavokawain A is a member of chalcones. |
2'-HYDROXY-4,4',6'-TRIMETHOXYCHALCONE Preparation Products And Raw materials