Introduction：Basic information about 2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester CAS 91442-24-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester Basic information
| Product Name: | 2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester |
| Synonyms: | 2-Phenylphenoxyethyl acrylate;2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester;OPPEA;2-(2-Biphenylyloxy)ethyl acrylate;Propenoic acid, 2-([1,1'-biphenyl]-2-yloxy)ethyl ester;Ortho-phenyl Phenoxy Ethyl Acrylate;2-([1,1'-Biphenyl]-2-yloxy)ethyl acrylate;OPPEA2-([1,1'-Biphenyl]-2-yloxy)ethyl acrylate |
| CAS: | 91442-24-9 |
| MF: | C17H16O3 |
| MW: | 268.31 |
| EINECS: | 203-126-8 |
| Product Categories: | |
| Mol File: | 91442-24-9.mol |
|
2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester Chemical Properties
| Boiling point | 390.7±25.0 °C(Predicted) |
| density | 1.102 |
| form | Colorless or light yellow transparent liquid |
| InChI | InChI=1S/C17H16O3/c1-2-17(18)20-13-12-19-16-11-7-6-10-15(16)14-8-4-3-5-9-14/h2-11H,1,12-13H2 |
| InChIKey | VAZQKPWSBFZARZ-UHFFFAOYSA-N |
| SMILES | C(OCCOC1=CC=CC=C1C1=CC=CC=C1)(=O)C=C |
Safety Information
2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester Usage And Synthesis
| Uses | 2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester is used in coatings, inks, and adhesives. |
2-Propenoic acid 2-([1,1'-biphenyl]-2-yloxy)ethyl ester Preparation Products And Raw materials
| Raw materials | 2-(2-BIPHENYLYLOXY)ETHANOL-->2-Phenylphenol-->Ethyl acrylate-->2-Hydroxyethyl acrylate |
