Introduction：Basic information about 2-PROPANOL-D8 CAS 22739-76-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-PROPANOL-D8 Basic information
| Product Name: | 2-PROPANOL-D8 |
| Synonyms: | 2-PROPANOL-D8;2-PROPANOLE-D8;2-PROPYL ALCOHOL D8;IPA-D8;ISOPROPANOL-D8;ISOPROPYL ALCOHOL-D8;Isopropanol-d8, Octadeuteroisopropanol;(O,1,1,1,2,3,3,3-2H8)propan-2-ol |
| CAS: | 22739-76-0 |
| MF: | C3D8O |
| MW: | 68.14 |
| EINECS: | 245-189-2 |
| Product Categories: | |
| Mol File: | 22739-76-0.mol |
|
2-PROPANOL-D8 Chemical Properties
| Melting point | -89°C |
| Melting point | -89.5°C |
| Boiling point | 82 °C(lit.) |
| Boiling point | 83°C |
| density | d = 0,90 |
| density | 0.890 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.3728(lit.) |
| Fp | 75 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| explosive limit | 2-12.7%(V) |
| Water Solubility | Completely soluble in water. |
| BRN | 1816231 |
| Stability: | Stable. Highly flammable. Incompatible with acids, strong oxidizing agents, acid anhydrides, halogens, aluminium. |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D |
| InChIKey | KFZMGEQAYNKOFK-PIODKIDGSA-N |
| SMILES | C([2H])(O[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-67-36 |
| Safety Statements | 7-16-26-24/25-2017/7/16 |
| RIDADR | UN 1219 3/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2
Flam. Liq. 2
STOT SE 3 |
2-PROPANOL-D8 Usage And Synthesis
| Chemical Properties | colourless liquid |
| Uses | 2-Propanol-d{8} is used as an intermediate in chemical research and in pharmaceutics. |
| General Description | 2-Propanol-d8 (Isopropanol-d8) is a deuterated derivative of isopropanol. Generation and decay of correlated radical pairs (SCRP) during the reduction of acetone(D6) in 2-propanol(D8) have been studied by Fourier transform-electron paramagnetic resonance (FT-EPR) spectroscopy. It participates as solvent during the evaluation of triplet decay constants, triplet lifetime and photoreduction rate constants of benzophenone. |
2-PROPANOL-D8 Preparation Products And Raw materials
| Raw materials | ACETONE-D6-->Isopropanol-d-->Isopropyl alcohol |
| Preparation Products | 2-BROMOPROPANE-D7-->(S)-Isopropyl-2-aminopropanoate-d7 Hydrochloride |
