Introduction：Basic information about 4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene CAS 2397-00-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene Basic information
| Product Name: | 4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene |
| Synonyms: | 2,2’-(1,2-ethenediyldi-4,1-phenylene)bis[5-methyl-benzoxazol;2,2’-(1,2-ethenediyldi-4,1-phenylene)bis[5-methyl-Benzoxazole;-Bis(5-methyl-2-benzoxazolyl)stilbene;2,2’-(1,2-Ethenediyldi-4,1-phenylene)bis[5-methylbenzoxazole];4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene (refined product of B1564);Benzoxazole,2,2’-(1,2-ethenediyldi-4,1-phenylene)bis[5-methyl-;bismethylbenzoxazolylstilbene;Fluorescent Brightener Agent OB-2 |
| CAS: | 2397-00-4 |
| MF: | C30H22N2O2 |
| MW: | 442.51 |
| EINECS: | 219-260-3 |
| Product Categories: | Refined Products by Sublimation;Electroluminescence;Functional Materials;Stilbenes;Highly Purified Reagents;Other Categories |
| Mol File: | 2397-00-4.mol |
|
4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene Chemical Properties
| Melting point | 336-342°C |
| Boiling point | 590.9±39.0 °C(Predicted) |
| density | 1.242±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot DMF |
| pka | 2.95±0.10(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Water Solubility | 2.236ng/L at 25℃ |
| InChI | InChI=1S/C30H22N2O2/c1-19-3-15-27-25(17-19)31-29(33-27)23-11-7-21(8-12-23)5-6-22-9-13-24(14-10-22)30-32-26-18-20(2)4-16-28(26)34-30/h3-18H,1-2H3 |
| InChIKey | OKEZAUMKBWTTCR-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C2=NC3=CC(C)=CC=C3O2)C=C1)=CC1=CC=C(C2=NC3=CC(C)=CC=C3O2)C=C1 |
| LogP | 8.6 |
| CAS DataBase Reference | 2397-00-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoxazole, 2,2'-(1,2-ethenediyldi-4,1-phenylene)bis[5-methyl- (2397-00-4) |
Safety Information
| TSCA | TSCA listed |
| HS Code | 2934.99.4400 |
4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene Usage And Synthesis
| Flammability and Explosibility | Not classified |
4,4'-Bis(5-methyl-2-benzoxazolyl)stilbene Preparation Products And Raw materials
