Introduction：Basic information about 4-Chloro-3-fluoronitrobenzene CAS 350-31-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Chloro-3-fluoronitrobenzene Basic information
| Product Name: | 4-Chloro-3-fluoronitrobenzene |
| Synonyms: | 4-Chloro-3-fluoronitrobenzenen;3-FLUORO-4-CHLORONITROBENZENE;4-CHLORO-3-FLUORONITROBENZENE;1-chloro-2-fluoro-4-nitrobenzene;3-FLUORO-4-CHLORONITROBENZENE,99%;1-Chloro-2-fluoro-4-nitrobenzene >2-Fluoro-4-nitrochlorobenzene;uoro-4-nitrobenzene |
| CAS: | 350-31-2 |
| MF: | C6H3ClFNO2 |
| MW: | 175.54 |
| EINECS: | 206-500-7 |
| Product Categories: | Aromatic Halides (substituted) |
| Mol File: | 350-31-2.mol |
|
4-Chloro-3-fluoronitrobenzene Chemical Properties
| Melting point | 61 °C |
| Boiling point | 116 °C / 24mmHg |
| density | 1.494±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C6H3ClFNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| InChIKey | CSSSAKOGRYYMSA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C([N+]([O-])=O)C=C1F |
| CAS DataBase Reference | 350-31-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2904990090 |
4-Chloro-3-fluoronitrobenzene Usage And Synthesis
| Uses | 4-Chloro-3-fluoronitrobenzene is a nitrobenzene compound containing fluorine and chlorine atoms, which can be used as an intermediate in organic synthesis or as a reagent in chemical reactions. It can be used in fluorination reactions. |
4-Chloro-3-fluoronitrobenzene Preparation Products And Raw materials
| Preparation Products | 3-Chloro-4-fluoronitrobenzene |
