Introduction：Basic information about 4-FLUORO-2-IODOTOLUENE CAS 13194-67-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-FLUORO-2-IODOTOLUENE Basic information
| Product Name: | 4-FLUORO-2-IODOTOLUENE |
| Synonyms: | 4-Fluoro-2-iodotoluene 98%;4-Fluoro-2-iodotoluene98%;BENZENE,4-FLUORO-2-IODO-1-METHYL;2-IODO-4-FLUOROTOLUENE;4-FLUORO-2-IODOTOLUENE;4-FLUORO-2-IODO-1-METHYLBENZENE;1-Methyl-2-iodo-4-fluorobenzene;4-Fluoro-2-iodo-1-toluene |
| CAS: | 13194-67-7 |
| MF: | C7H6FI |
| MW: | 236.03 |
| EINECS: | 236-153-7 |
| Product Categories: | Aryl;C7;Halogenated Hydrocarbons;Fluorobenzene;Fluoro-contained Iodo series;Halogen toluene;Miscellaneous;Fluorine Compounds;Iodine Compounds |
| Mol File: | 13194-67-7.mol |
|
4-FLUORO-2-IODOTOLUENE Chemical Properties
| Boiling point | 92-94 °C15 mm Hg(lit.) |
| density | 1.752 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.5800(lit.) |
| Fp | 188 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Orange to Green |
| Sensitive | Light Sensitive |
| BRN | 2242594 |
| InChI | InChI=1S/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey | RZGYAMQMAVTAKP-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1I |
| CAS DataBase Reference | 13194-67-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,Xi |
| Risk Statements | 25-52/53-36/37/38 |
| Safety Statements | 45-37/39-26 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
4-FLUORO-2-IODOTOLUENE Usage And Synthesis
| Chemical Properties | colorless to light yellow liqui |
4-FLUORO-2-IODOTOLUENE Preparation Products And Raw materials
| Preparation Products | 5-Fluoro-2-Methyl-3-nitrobenzoic acid-->2-Acetamido-5-bromotoluene |
